![6-Methylimidazo[1,2-a]pyridine-2-carboxylic acid (CAS: 80353-93-1) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0692915.png "6-Methylimidazo[1,2-a]pyridine-2-carboxylic acid chemical structure")
6-Methylimidazo[1,2-a]pyridine-2-carboxylic acid
Catalog No: FT-0692915
CAS No: 80353-93-1
- Chemical Name: 6-Methylimidazo[1,2-a]pyridine-2-carboxylic acid
- Molecular Formula: C9H8N2O2
- Molecular Weight: 176.17
- InChI Key: RFSQTKHVHYSKLX-UHFFFAOYSA-N
- InChI: InChI=1S/C9H8N2O2/c1-6-2-3-8-10-7(9(12)13)5-11(8)4-6/h2-5H,1H3,(H,12,13)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 176.172 |
| Density: | 1.4±0.1 g/cm3 |
| CAS: | 80353-93-1 |
| Bolling_Point: | N/A |
| Product_Name: | 6-methylimidazo[1,2-a]pyridine-2-carboxylicacid |
| Melting_Point: | N/A |
| Flash_Point: | N/A |
| MF: | C9H8N2O2 |
| Density: | 1.4±0.1 g/cm3 |
|---|---|
| LogP: | 1.90 |
| Refractive_Index: | 1.653 |
| FW: | 176.172 |
| PSA: | 54.60000 |
| MF: | C9H8N2O2 |
| Exact_Mass: | 176.058578 |
| Hazard_Codes: | Xi |
|---|---|
| Warning_Statement: | P280 |
| Safety_Statements: | H317 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933990090 |
![2-[4-[(dimethylamino)methyl]phenyl]acetic acid (CAS: 99985-52-1) - Related Chemical Product](/static/img/prod_pic/FT-0737063.png "2-[4-[(dimethylamino)methyl]phenyl]acetic acid chemical structure")
![2-[2-hydroxyethyl-[(4-nitrophenyl)methyl]amino]ethanol (CAS: 99982-60-2) - Related Chemical Product](/static/img/prod_pic/FT-0749988.png "2-[2-hydroxyethyl-[(4-nitrophenyl)methyl]amino]ethanol chemical structure")
